6-oxo-Δ15-hexadecanoic acid
Modify Date: 2024-01-04 16:14:19
6-oxo-Δ15-hexadecanoic acid structure
|
Common Name | 6-oxo-Δ15-hexadecanoic acid | ||
|---|---|---|---|---|
| CAS Number | 76402-73-8 | Molecular Weight | 268.39200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H28O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-oxo-Δ15-hexadecanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H28O3 |
|---|---|
| Molecular Weight | 268.39200 |
| Exact Mass | 268.20400 |
| PSA | 54.37000 |
| LogP | 4.50730 |
| InChIKey | USQSWHMDEPIEEL-UHFFFAOYSA-N |
| SMILES | C=CCCCCCCCCC(=O)CCCCC(=O)O |
| HS Code | 2918300090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:4675-57-4| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 6-Oxo-Δ15-hexadecensaeure |
| 6-Oxo-hexadec-15-ensaeure |
| 6-Oxo-hexadec-15-en-1-saeure |
| 6-oxo-15-hexadecenoic acid |
| 6-oxo-hexadec-15-enoic acid |
| 6-Oxo-hexadecen-(15)-saeure-(1) |