3-(4-ethylphenyl)-1-(2-methoxyphenyl)urea
Modify Date: 2024-04-02 20:08:56
3-(4-ethylphenyl)-1-(2-methoxyphenyl)urea structure
|
Common Name | 3-(4-ethylphenyl)-1-(2-methoxyphenyl)urea | ||
|---|---|---|---|---|
| CAS Number | 76393-39-0 | Molecular Weight | 270.32600 | |
| Density | 1.192g/cm3 | Boiling Point | 332.5ºC at 760 mmHg | |
| Molecular Formula | C16H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.9ºC | |
| Name | 1-(4-ethylphenyl)-3-(2-methoxyphenyl)urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.192g/cm3 |
|---|---|
| Boiling Point | 332.5ºC at 760 mmHg |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.32600 |
| Flash Point | 154.9ºC |
| Exact Mass | 270.13700 |
| PSA | 50.36000 |
| LogP | 4.04760 |
| Index of Refraction | 1.636 |
| InChIKey | WHHKRMHBVACPTK-UHFFFAOYSA-N |
| SMILES | CCc1ccc(NC(=O)Nc2ccccc2OC)cc1 |
| HS Code | 2924299090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-ethyl-2'-methoxycarbanilide |