1-[2-(4-fluorophenyl)-2-oxo-ethyl]pyridine-5-carbonitrile structure
|
Common Name | 1-[2-(4-fluorophenyl)-2-oxo-ethyl]pyridine-5-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 7639-76-1 | Molecular Weight | 321.14400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10BrFN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[2-(4-fluorophenyl)-2-oxoethyl]pyridin-1-ium-3-carbonitrile,bromide |
|---|
| Molecular Formula | C14H10BrFN2O |
|---|---|
| Molecular Weight | 321.14400 |
| Exact Mass | 319.99600 |
| PSA | 44.74000 |
| InChIKey | CKBSWYROHNOZHE-UHFFFAOYSA-M |
| SMILES | N#Cc1ccc[n+](CC(=O)c2ccc(F)cc2)c1.[Br-] |
|
~%
1-[2-(4-fluorop... CAS#:7639-76-1 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1952 , vol. 74, p. 3960 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |