1-cyano-N,N-bis(2-fluorophenyl)methanimidamide structure
|
Common Name | 1-cyano-N,N-bis(2-fluorophenyl)methanimidamide | ||
|---|---|---|---|---|
| CAS Number | 7639-58-9 | Molecular Weight | 257.23800 | |
| Density | 1.2g/cm3 | Boiling Point | 359.4ºC at 760 mmHg | |
| Molecular Formula | C14H9F2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.2ºC | |
| Name | 1-cyano-N,N'-bis(2-fluorophenyl)methanimidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 359.4ºC at 760 mmHg |
| Molecular Formula | C14H9F2N3 |
| Molecular Weight | 257.23800 |
| Flash Point | 171.2ºC |
| Exact Mass | 257.07600 |
| PSA | 48.18000 |
| LogP | 3.70348 |
| Index of Refraction | 1.568 |
| InChIKey | GBLYFHREDXDIIV-UHFFFAOYSA-N |
| SMILES | N#CC(=Nc1ccccc1F)Nc1ccccc1F |
|
~%
1-cyano-N,N-bis... CAS#:7639-58-9 |
| Literature: Roe; Teague Journal of the American Chemical Society, 1949 , vol. 71, p. 4019 |
|
~%
1-cyano-N,N-bis... CAS#:7639-58-9 |
| Literature: Roe; Teague Journal of the American Chemical Society, 1949 , vol. 71, p. 4019 |
| N-(2-Fluor-phenyl)-oxalomonoimidsaeure-(2-fluor-anilid)-nitril |
| N-(2-fluoro-phenyl)-oxalomonoimidic acid-(2-fluoro-anilide)-nitrile |
| N.N'-Bis-(2-fluor-phenyl)-C-cyan-formamidin |