3-chloro-4-(diphenylamino)-5-methyl-6-phenyl-pyran-2-one structure
|
Common Name | 3-chloro-4-(diphenylamino)-5-methyl-6-phenyl-pyran-2-one | ||
|---|---|---|---|---|
| CAS Number | 76312-44-2 | Molecular Weight | 387.85800 | |
| Density | 1.31g/cm3 | Boiling Point | 494.8ºC at 760 mmHg | |
| Molecular Formula | C24H18ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.1ºC | |
| Name | 3-chloro-5-methyl-6-phenyl-4-(N-phenylanilino)pyran-2-one |
|---|
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 494.8ºC at 760 mmHg |
| Molecular Formula | C24H18ClNO2 |
| Molecular Weight | 387.85800 |
| Flash Point | 253.1ºC |
| Exact Mass | 387.10300 |
| PSA | 33.45000 |
| LogP | 6.73840 |
| Index of Refraction | 1.676 |
| InChIKey | IUKHCOGQZUDJNN-UHFFFAOYSA-N |
| SMILES | Cc1c(-c2ccccc2)oc(=O)c(Cl)c1N(c1ccccc1)c1ccccc1 |
|
~%
3-chloro-4-(dip... CAS#:76312-44-2 |
| Literature: Bargagna, Alberto; Schenone, Pietro; Bondavalli, Francesco; Longobardi, Mario Journal of Heterocyclic Chemistry, 1980 , vol. 17, p. 1201 - 1206 |
|
~%
3-chloro-4-(dip... CAS#:76312-44-2 |
| Literature: Bargagna, Alberto; Schenone, Pietro; Bondavalli, Francesco; Longobardi, Mario Journal of Heterocyclic Chemistry, 1980 , vol. 17, p. 1201 - 1206 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |