3-chloro-4-diethylamino-5-methyl-6-phenyl-pyran-2-one
Modify Date: 2025-10-16 20:42:16
3-chloro-4-diethylamino-5-methyl-6-phenyl-pyran-2-one structure
|
Common Name | 3-chloro-4-diethylamino-5-methyl-6-phenyl-pyran-2-one | ||
|---|---|---|---|---|
| CAS Number | 76312-42-0 | Molecular Weight | 291.77300 | |
| Density | 1.2g/cm3 | Boiling Point | 372.1ºC at 760 mmHg | |
| Molecular Formula | C16H18ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.8ºC | |
| Name | 3-chloro-4-(diethylamino)-5-methyl-6-phenylpyran-2-one |
|---|
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 372.1ºC at 760 mmHg |
| Molecular Formula | C16H18ClNO2 |
| Molecular Weight | 291.77300 |
| Flash Point | 178.8ºC |
| Exact Mass | 291.10300 |
| PSA | 33.45000 |
| LogP | 4.11480 |
| Index of Refraction | 1.577 |
| InChIKey | DQOLRDQRHTVTBS-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1c(C)c(-c2ccccc2)oc(=O)c1Cl |
|
~%
3-chloro-4-diet... CAS#:76312-42-0 |
| Literature: Bargagna, Alberto; Schenone, Pietro; Bondavalli, Francesco; Longobardi, Mario Journal of Heterocyclic Chemistry, 1980 , vol. 17, p. 1201 - 1206 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |