1,2-Dimethyl-3-methoxy-9H-carbazol-4-ol acetate (ester)
Modify Date: 2025-11-09 14:10:09
1,2-Dimethyl-3-methoxy-9H-carbazol-4-ol acetate (ester) structure
|
Common Name | 1,2-Dimethyl-3-methoxy-9H-carbazol-4-ol acetate (ester) | ||
|---|---|---|---|---|
| CAS Number | 76306-36-0 | Molecular Weight | 283.32200 | |
| Density | 1.23g/cm3 | Boiling Point | 447.8ºC at 760 mmHg | |
| Molecular Formula | C17H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.7ºC | |
| Name | (3-methoxy-1,2-dimethyl-9H-carbazol-4-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 447.8ºC at 760 mmHg |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.32200 |
| Flash Point | 224.7ºC |
| Exact Mass | 283.12100 |
| PSA | 51.32000 |
| LogP | 3.87180 |
| Index of Refraction | 1.65 |
| InChIKey | MLOKDARVTQAWEK-UHFFFAOYSA-N |
| SMILES | COc1c(C)c(C)c2[nH]c3ccccc3c2c1OC(C)=O |
| HS Code | 2933990090 |
|---|
|
~55%
1,2-Dimethyl-3-... CAS#:76306-36-0 |
| Literature: Knoelker, Hans-Joachim; Froehner, Wolfgang Tetrahedron Letters, 1999 , vol. 40, # 38 p. 6915 - 6918 |
|
~%
1,2-Dimethyl-3-... CAS#:76306-36-0 |
| Literature: Knolker; Bauermeister Helvetica Chimica Acta, 1993 , vol. 76, # 7 p. 2500 - 2514 |
|
~%
1,2-Dimethyl-3-... CAS#:76306-36-0 |
| Literature: Knolker; Bauermeister Journal of the Chemical Society - Series Chemical Communications, 1989 , # 19 p. 1468 - 1470 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:75139-38-7| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-methoxy-1,2-dimethyl-9H-carbazol-4-yl acetate |
| 4-O-Acetylcarbazomycin B |
| O-Acetylcarbazomycin B |