3,3,3-trichloro-1-nitro-prop-1-ene
Modify Date: 2025-08-25 21:15:45
3,3,3-trichloro-1-nitro-prop-1-ene structure
|
Common Name | 3,3,3-trichloro-1-nitro-prop-1-ene | ||
|---|---|---|---|---|
| CAS Number | 763-16-6 | Molecular Weight | 190.41200 | |
| Density | 1.604g/cm3 | Boiling Point | 266.2ºC at 760 mmHg | |
| Molecular Formula | C3H2Cl3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 114.8ºC | |
| Name | (Z)-3,3,3-trichloro-1-nitroprop-1-ene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.604g/cm3 |
|---|---|
| Boiling Point | 266.2ºC at 760 mmHg |
| Molecular Formula | C3H2Cl3NO2 |
| Molecular Weight | 190.41200 |
| Flash Point | 114.8ºC |
| Exact Mass | 188.91500 |
| PSA | 45.82000 |
| LogP | 2.67020 |
| Index of Refraction | 1.528 |
| InChIKey | WFDXHJPDAZMBMW-UPHRSURJSA-N |
| SMILES | O=[N+]([O-])C=CC(Cl)(Cl)Cl |
|
~%
3,3,3-trichloro... CAS#:763-16-6 |
| Literature: Irving; Fuller Journal of the Chemical Society, 1948 , p. 1989 |
CAS#:65683-44-5![6-nitro-5-(trichloromethyl)bicyclo[2.2.1]hept-2-ene structure](https://image.chemsrc.com/caspic/270/90003-69-3.png)
CAS#:90003-69-3
CAS#:92436-69-6
CAS#:53607-76-4| 3,3,3-Trichlor-1-nitro-propen |
| 1,1,1-Trichlor-3-nitro-prop-2-en |
| 3,3,3-trichloro-1-nitro-propene |
| 1 nitro-3,3,3 trichloropropene |
| 4,4,4-Trichlor-crotonsaeure-ethylester |
| ethyl 4,4,4-trichlorobutenoate |
| 4,4,4-Trichlorbutenoat |
| 3,3,3-Trichlor-crotonsaeure-ethylester |