N-[4-(benzyliminomethyl)phenyl]acetamide structure
|
Common Name | N-[4-(benzyliminomethyl)phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 76269-55-1 | Molecular Weight | 252.31100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[4-(benzyliminomethyl)phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H16N2O |
|---|---|
| Molecular Weight | 252.31100 |
| Exact Mass | 252.12600 |
| PSA | 44.95000 |
| LogP | 3.91360 |
| InChIKey | PZVNJSYZZJKYQA-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(C=NCc2ccccc2)cc1 |
|
~%
N-[4-(benzylimi... CAS#:76269-55-1 |
| Literature: Shoppee Journal of the Chemical Society, 1931 , p. 1225,1232 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Acetylamino-benzaldehyd-benzylimin |
| 4-acetylaminobenzylidenebenzylamine |
| 4-Acetamino-benzaldehyd-benzylimin |
| 4-acetylamino-benzaldehyde benzylimine |