2,2-Dimethyl-7-morpholin-4-yl-4H,5H-pyrano[4,3-d][1,3]dioxine-4,5-dione structure
|
Common Name | 2,2-Dimethyl-7-morpholin-4-yl-4H,5H-pyrano[4,3-d][1,3]dioxine-4,5-dione | ||
|---|---|---|---|---|
| CAS Number | 76245-27-7 | Molecular Weight | 281.26100 | |
| Density | 1.41g/cm3 | Boiling Point | 451.2ºC at 760 mmHg | |
| Molecular Formula | C13H15NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.7ºC | |
| Name | 2,2-dimethyl-7-morpholin-4-ylpyrano[4,3-d][1,3]dioxine-4,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 451.2ºC at 760 mmHg |
| Molecular Formula | C13H15NO6 |
| Molecular Weight | 281.26100 |
| Flash Point | 226.7ºC |
| Exact Mass | 281.09000 |
| PSA | 78.21000 |
| LogP | 0.82670 |
| Index of Refraction | 1.581 |
| InChIKey | DDBXQDMXOVFWHR-UHFFFAOYSA-N |
| SMILES | CC1(C)OC(=O)c2c(cc(N3CCOCC3)oc2=O)O1 |
|
~0%
2,2-Dimethyl-7-... CAS#:76245-27-7
Detail
|
| Literature: Takeuchi, Naoki; Nakagawa, Hideo; Kamisato, Masahiro; Tobinaga, Seisho Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 8 p. 2460 - 2467 |
|
~%
2,2-Dimethyl-7-... CAS#:76245-27-7 |
| Literature: Davis; Elvidge Journal of the Chemical Society, 1953 , p. 2251,2252 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,2-dimethyl-7-morpholino-2H,4H,5H-pyrano(4,3-d)-1,3-dioxin-4,5-dione |
| 2,2-dimethyl-7-morpholino-pyrano[4,3-d][1,3]dioxin-4,5-dione |
| 2,2-Dimethyl-7-morpholino-pyrano[4,3-d][1,3]dioxin-4,5-dion |
| 2,2-Dimethyl-7-morpholin-4-yl-4H,5H-pyrano(4,3-d)(1,3)dioxine-4,5-dione |