CHEMBRDG-BB 5941601
Modify Date: 2025-09-25 15:59:32
CHEMBRDG-BB 5941601 structure
|
Common Name | CHEMBRDG-BB 5941601 | ||
|---|---|---|---|---|
| CAS Number | 76209-00-2 | Molecular Weight | 207.22600 | |
| Density | 1.233g/cm3 | Boiling Point | 447.6ºC at 760 mmHg | |
| Molecular Formula | C11H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.5ºC | |
| Name | 3-(butanoylamino)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 447.6ºC at 760 mmHg |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.22600 |
| Flash Point | 224.5ºC |
| Exact Mass | 207.09000 |
| PSA | 66.40000 |
| LogP | 2.19640 |
| Index of Refraction | 1.59 |
| InChIKey | ASXLJZIPYBUVFW-UHFFFAOYSA-N |
| SMILES | CCCC(=O)Nc1cccc(C(=O)O)c1 |
| HS Code | 2924299090 |
|---|
|
~64%
CHEMBRDG-BB 5941601 CAS#:76209-00-2 |
| Literature: Krauss, Juergen; Knorr, Veronika; Manhardt, Vera; Scheffels, Stefanie; Bracher, Franz Archiv der Pharmazie, 2008 , vol. 341, # 6 p. 386 - 392 |
|
~%
CHEMBRDG-BB 5941601 CAS#:76209-00-2 |
| Literature: Pellizzari Gazzetta Chimica Italiana, 1885 , vol. 15, p. 567 Justus Liebigs Annalen der Chemie, 1886 , vol. 232, p. 153 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-butyrylamino-benzoic acid |
| 3-butanamidobenzoic acid |
| m-Butyramidobenzoicacid |
| 3-Butyrylamino-benzoesaeure |