methyl 2-isocyano-3-thiophen-2-ylbut-2-enoate structure
|
Common Name | methyl 2-isocyano-3-thiophen-2-ylbut-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 76203-07-1 | Molecular Weight | 207.24900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-isocyano-3-thiophen-2-ylbut-2-enoate |
|---|
| Molecular Formula | C10H9NO2S |
|---|---|
| Molecular Weight | 207.24900 |
| Exact Mass | 207.03500 |
| PSA | 54.54000 |
| LogP | 1.80210 |
| InChIKey | DFIMPPQSQUZCPG-UHFFFAOYSA-N |
| SMILES | [C-]#[N+]C(C(=O)OC)=C(C)c1cccs1 |
|
~97%
methyl 2-isocya... CAS#:76203-07-1 |
| Literature: Suzuki; Nunami; Matsumoto; et al. Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 8 p. 2374 - 2383 |
|
~%
methyl 2-isocya... CAS#:76203-07-1 |
| Literature: Suzuki; Nunami; Matsumoto; et al. Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 8 p. 2374 - 2383 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |