1-(2-chlorophenyl)-3-(4-methoxyphenyl)-5-[(2-methylphenyl)hydrazinylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione structure
|
Common Name | 1-(2-chlorophenyl)-3-(4-methoxyphenyl)-5-[(2-methylphenyl)hydrazinylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione | ||
|---|---|---|---|---|
| CAS Number | 76153-33-8 | Molecular Weight | 478.95100 | |
| Density | 1.35g/cm3 | Boiling Point | 604.1ºC at 760 mmHg | |
| Molecular Formula | C24H19ClN4O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 319.1ºC | |
| Name | (5E)-1-(2-chlorophenyl)-3-(4-methoxyphenyl)-5-[(2-methylphenyl)hydrazinylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 604.1ºC at 760 mmHg |
| Molecular Formula | C24H19ClN4O3S |
| Molecular Weight | 478.95100 |
| Flash Point | 319.1ºC |
| Exact Mass | 478.08700 |
| PSA | 113.20000 |
| LogP | 6.44910 |
| Index of Refraction | 1.668 |
| InChIKey | ZANSDMVEGIXFOU-UHFFFAOYSA-N |
| SMILES | COc1ccc(-n2c(=O)c(N=Nc3ccccc3C)c(O)n(-c3ccccc3Cl)c2=S)cc1 |
|
~%
1-(2-chlorophen... CAS#:76153-33-8 |
| Literature: Singh, S.; Behl, C. K. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1980 , vol. 19, # 7 p. 625 - 626 |
|
~%
1-(2-chlorophen... CAS#:76153-33-8 |
| Literature: Singh, S.; Behl, C. K. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1980 , vol. 19, # 7 p. 625 - 626 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |