WAY-301122
Modify Date: 2024-04-03 11:31:34
WAY-301122 structure
|
Common Name | WAY-301122 | ||
|---|---|---|---|---|
| CAS Number | 76111-24-5 | Molecular Weight | 352.24 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 539.8±60.0 °C at 760 mmHg | |
| Molecular Formula | C15H11Cl2N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.3±32.9 °C | |
Use of WAY-301122cytotoxity (targeted to DNA topoisomerase II); anti-cancer activity; fungicides; |
| Name | WAY-301122 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 539.8±60.0 °C at 760 mmHg |
| Molecular Formula | C15H11Cl2N3OS |
| Molecular Weight | 352.24 |
| Flash Point | 280.3±32.9 °C |
| Exact Mass | 351.000000 |
| LogP | 5.64 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.683 |
| InChIKey | NBGDUTFBYUEICO-UHFFFAOYSA-N |
| SMILES | S=c1[nH]nc(COc2ccc(Cl)cc2)n1-c1ccc(Cl)cc1 |
| MFCD01166518 |
| 5-[(4-Chlorophenoxy)methyl]-4-(4-chlorophenyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione |
| 3H-1,2,4-Triazole-3-thione, 5-[(4-chlorophenoxy)methyl]-4-(4-chlorophenyl)-2,4-dihydro- |