[1-(2,3-dihydroxypropyl)benzimidazol-2-yl]-phenylmethanone
Modify Date: 2025-08-22 21:59:38
![[1-(2,3-dihydroxypropyl)benzimidazol-2-yl]-phenylmethanone Structure](https://image.chemsrc.com/caspic/067/76099-41-7.png)
[1-(2,3-dihydroxypropyl)benzimidazol-2-yl]-phenylmethanone structure
|
Common Name | [1-(2,3-dihydroxypropyl)benzimidazol-2-yl]-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 76099-41-7 | Molecular Weight | 296.32100 | |
| Density | 1.29g/cm3 | Boiling Point | 574.9ºC at 760 mmHg | |
| Molecular Formula | C17H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.5ºC | |
| Name | [1-(2,3-dihydroxypropyl)benzimidazol-2-yl]-phenylmethanone |
|---|
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 574.9ºC at 760 mmHg |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.32100 |
| Flash Point | 301.5ºC |
| Exact Mass | 296.11600 |
| PSA | 75.35000 |
| LogP | 1.62050 |
| Index of Refraction | 1.646 |
| InChIKey | UZTKCNNXSNTHNQ-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1nc2ccccc2n1CC(O)CO |
|
~8%
[1-(2,3-dihydro... CAS#:76099-41-7 |
| Literature: Guerret; Ancher; Langlois Journal of Heterocyclic Chemistry, 1983 , vol. 20, # 6 p. 1525 - 1532 |
![4,5-dihydro-1-phenyl-1,4-epoxy-1H,3H [1,4] oxazepino [4,3-a] benzimidazole structure](https://image.chemsrc.com/caspic/263/344866-89-3.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |