Thioxanthone sulfoxide
Modify Date: 2025-08-21 08:41:13
Thioxanthone sulfoxide structure
|
Common Name | Thioxanthone sulfoxide | ||
|---|---|---|---|---|
| CAS Number | 7605-15-4 | Molecular Weight | 228.26600 | |
| Density | 1.47g/cm3 | Boiling Point | 447ºC at 760 mmHg | |
| Molecular Formula | C13H8O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.1ºC | |
| Name | 10-oxothioxanthen-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 447ºC at 760 mmHg |
| Molecular Formula | C13H8O2S |
| Molecular Weight | 228.26600 |
| Flash Point | 224.1ºC |
| Exact Mass | 228.02500 |
| PSA | 55.84000 |
| LogP | 3.29590 |
| Index of Refraction | 1.749 |
| InChIKey | YEZOVIIHKKPUOS-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2S(=O)c2ccccc21 |
|
~99%
Thioxanthone su... CAS#:7605-15-4 |
| Literature: Bahrami Tetrahedron Letters, 2006 , vol. 47, # 12 p. 2009 - 2012 |
|
~48%
Thioxanthone su... CAS#:7605-15-4 |
| Literature: Barbas, Dimitris; Spyroudis, Spyros; Varvoglis, Anastasios Journal of Chemical Research, Miniprint, 1985 , # 6 p. 2201 - 2214 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| Thioxanthone sulfoxide |
| Thioxanthone 10-oxide |
| 10-oxo-thioxanthen-9-one |
| 10-Thioxanthenone 5-oxide |
| thioxanthone S-oxide |
| thioxanthen-9-one-S-oxide |
| thioxanthone sulphoxide |
| thioxanthen-9-one 10-oxide |
| thioxanthanone S-oxide |