6-chloro-N-(3,5-dichlorophenyl)-N-(1-ethyl-3-piperidyl)quinazoline-2,4-diamine structure
|
Common Name | 6-chloro-N-(3,5-dichlorophenyl)-N-(1-ethyl-3-piperidyl)quinazoline-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 76004-90-5 | Molecular Weight | 487.25300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H23Cl4N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-chloro-2-N-(3,5-dichlorophenyl)-4-N-(1-ethylpiperidin-3-yl)quinazoline-2,4-diamine,hydrochloride |
|---|
| Molecular Formula | C21H23Cl4N5 |
|---|---|
| Molecular Weight | 487.25300 |
| Exact Mass | 485.07100 |
| PSA | 53.08000 |
| LogP | 7.11570 |
| InChIKey | OVOPEOJHVJXILP-UHFFFAOYSA-N |
| SMILES | CCN1CCCC(Nc2nc(Nc3cc(Cl)cc(Cl)c3)nc3ccc(Cl)cc23)C1.Cl |
|
~52%
6-chloro-N-(3,5... CAS#:76004-90-5 |
| Literature: Elslager; Hess; Johnson; Ortwine; Chu; Werbel Journal of Medicinal Chemistry, 1981 , vol. 24, # 2 p. 127 - 140 |
|
~%
6-chloro-N-(3,5... CAS#:76004-90-5 |
| Literature: Elslager; Hess; Johnson; Ortwine; Chu; Werbel Journal of Medicinal Chemistry, 1981 , vol. 24, # 2 p. 127 - 140 |
|
~%
6-chloro-N-(3,5... CAS#:76004-90-5 |
| Literature: Elslager; Hess; Johnson; Ortwine; Chu; Werbel Journal of Medicinal Chemistry, 1981 , vol. 24, # 2 p. 127 - 140 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |