1,4-dichloro-2-dimethoxyphosphoryloxy-5-methoxy-benzene
Modify Date: 2025-09-10 12:24:31
1,4-dichloro-2-dimethoxyphosphoryloxy-5-methoxy-benzene structure
|
Common Name | 1,4-dichloro-2-dimethoxyphosphoryloxy-5-methoxy-benzene | ||
|---|---|---|---|---|
| CAS Number | 7595-66-6 | Molecular Weight | 301.06000 | |
| Density | 1.402g/cm3 | Boiling Point | 335.7ºC at 760 mmHg | |
| Molecular Formula | C9H11Cl2O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.3ºC | |
| Name | (2,5-dichloro-4-methoxyphenyl) dimethyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.402g/cm3 |
|---|---|
| Boiling Point | 335.7ºC at 760 mmHg |
| Molecular Formula | C9H11Cl2O5P |
| Molecular Weight | 301.06000 |
| Flash Point | 220.3ºC |
| Exact Mass | 299.97200 |
| PSA | 63.80000 |
| LogP | 3.78170 |
| Index of Refraction | 1.511 |
| InChIKey | MZFBIIAXRHYSPA-UHFFFAOYSA-N |
| SMILES | COc1cc(Cl)c(OP(=O)(OC)OC)cc1Cl |
|
~%
1,4-dichloro-2-... CAS#:7595-66-6 |
| Literature: Ramirez et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 4338,4341 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:18113-14-9| phosphoric acid-(2,5-dichloro-4-methoxy-phenyl ester)-dimethyl ester |
| Phosphorsaeure-(2,5-dichlor-4-methoxy-phenylester)-dimethylester |