1,4-dihydroxy-3-deoxy-A-homo-19-nor-9,10-secocholesta-4,7-diene structure
|
Common Name | 1,4-dihydroxy-3-deoxy-A-homo-19-nor-9,10-secocholesta-4,7-diene | ||
|---|---|---|---|---|
| CAS Number | 75946-87-1 | Molecular Weight | 402.65300 | |
| Density | 1.055g/cm3 | Boiling Point | 531.1ºC at 760 mmHg | |
| Molecular Formula | C27H46O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.4ºC | |
| Name | 6-[(2Z)-2-[7a-methyl-1-(6-methylheptan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cycloheptane-1,4-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.055g/cm3 |
|---|---|
| Boiling Point | 531.1ºC at 760 mmHg |
| Molecular Formula | C27H46O2 |
| Molecular Weight | 402.65300 |
| Flash Point | 221.4ºC |
| Exact Mass | 402.35000 |
| PSA | 40.46000 |
| LogP | 6.81380 |
| Index of Refraction | 1.58 |
| InChIKey | YMBNJMCCFCSRBU-ZPEIZEFESA-N |
| SMILES | CC(C)CCCC(C)C1CCC2C(=CC=C3CC(O)CCC(O)C3)CCCC21C |
|
~84%
1,4-dihydroxy-3... CAS#:75946-87-1 |
| Literature: Gerdes; Norman; Okamura Journal of Organic Chemistry, 1981 , vol. 46, # 3 p. 599 - 602 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,4-Dihydroxy-3-deoxy-A-homo-19-nor-9,10-secocholesta-4,7-diene |
| 1,4-Ddhns |