b-D-Ribofuranuronamide,1-deoxy-1-(3,4-dihydro-2,4-dioxo-1(2H)-pyrimidinyl)-N-[2-[[(methylamino)carbonyl]amino]ethyl]- structure
|
Common Name | b-D-Ribofuranuronamide,1-deoxy-1-(3,4-dihydro-2,4-dioxo-1(2H)-pyrimidinyl)-N-[2-[[(methylamino)carbonyl]amino]ethyl]- | ||
|---|---|---|---|---|
| CAS Number | 75930-31-3 | Molecular Weight | 357.31900 | |
| Density | 1.543g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H19N5O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-N-[2-(methylcarbamoylamino)ethyl]oxolane-2-carboxamide |
|---|
| Density | 1.543g/cm3 |
|---|---|
| Molecular Formula | C13H19N5O7 |
| Molecular Weight | 357.31900 |
| Exact Mass | 357.12800 |
| PSA | 174.78000 |
| Index of Refraction | 1.611 |
| InChIKey | CIGNZGKXVSVSNC-UHFFFAOYSA-N |
| SMILES | CNC(=O)NCCNC(=O)C1OC(n2ccc(=O)[nH]c2=O)C(O)C1O |
|
~44%
b-D-Ribofuranur... CAS#:75930-31-3 |
| Literature: Montgomery, John A.; Thomas, H. Jeanette; Brockman, R. Wallace; Wheeler, Glynn P. Journal of Medicinal Chemistry, 1981 , vol. 24, # 2 p. 184 - 189 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |