8-(Trichloromethyl)-7,8-dihydroberberine-13-carboxaldehyde structure
|
Common Name | 8-(Trichloromethyl)-7,8-dihydroberberine-13-carboxaldehyde | ||
|---|---|---|---|---|
| CAS Number | 75767-39-4 | Molecular Weight | 482.74100 | |
| Density | 1.55g/cm3 | Boiling Point | 644.8ºC at 760 mmHg | |
| Molecular Formula | C22H18Cl3NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 343.8ºC | |
| Name | 8-(Trichloromethyl)-7,8-dihydroberberine-13-carboxaldehyde |
|---|
| Density | 1.55g/cm3 |
|---|---|
| Boiling Point | 644.8ºC at 760 mmHg |
| Molecular Formula | C22H18Cl3NO5 |
| Molecular Weight | 482.74100 |
| Flash Point | 343.8ºC |
| Exact Mass | 481.02500 |
| PSA | 57.23000 |
| LogP | 4.72060 |
| Index of Refraction | 1.676 |
| InChIKey | SKLGUSDGDGKUHE-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1OC)C(C(Cl)(Cl)Cl)N1CCc3cc4c(cc3C1=C2C=O)OCO4 |
|
~56%
8-(Trichloromet... CAS#:75767-39-4 |
| Literature: Manikumar, Govindarajan; Shamma, Maurice Journal of Organic Chemistry, 1981 , vol. 46, # 2 p. 386 - 389 |
|
~%
8-(Trichloromet... CAS#:75767-39-4 |
| Literature: Manikumar, Govindarajan; Shamma, Maurice Journal of Organic Chemistry, 1981 , vol. 46, # 2 p. 386 - 389 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |