1,1'-[propane-1,3-diylbis(oxy)]bis[2,4-dinitrobenzene] structure
|
Common Name | 1,1'-[propane-1,3-diylbis(oxy)]bis[2,4-dinitrobenzene] | ||
|---|---|---|---|---|
| CAS Number | 75762-43-5 | Molecular Weight | 408.27700 | |
| Density | 1.557g/cm3 | Boiling Point | 635ºC at 760 mmHg | |
| Molecular Formula | C15H12N4O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.1ºC | |
| Name | 1-[3-(2,4-dinitrophenoxy)propoxy]-2,4-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.557g/cm3 |
|---|---|
| Boiling Point | 635ºC at 760 mmHg |
| Molecular Formula | C15H12N4O10 |
| Molecular Weight | 408.27700 |
| Flash Point | 277.1ºC |
| Exact Mass | 408.05500 |
| PSA | 201.74000 |
| LogP | 5.26010 |
| Index of Refraction | 1.641 |
| InChIKey | IXBVTQBLDYIPSB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OCCCOc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
|
~%
1,1'-[propane-1... CAS#:75762-43-5 |
| Literature: Fairbourne; Foster Journal of the Chemical Society, 1925 , vol. 127, p. 2763 |
|
~%
1,1'-[propane-1... CAS#:75762-43-5 |
| Literature: Whalley Journal of the Chemical Society, 1950 , p. 2241 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| einecs 278-303-4 |