1,2-dichloro-1,1,2,4,4-pentafluoro-4-iodobutane
Modify Date: 2025-09-18 15:04:01
1,2-dichloro-1,1,2,4,4-pentafluoro-4-iodobutane structure
|
Common Name | 1,2-dichloro-1,1,2,4,4-pentafluoro-4-iodobutane | ||
|---|---|---|---|---|
| CAS Number | 757-01-7 | Molecular Weight | 342.86100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4H2Cl2F5I | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2-dichloro-1,1,2,4,4-pentafluoro-4-iodobutane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C4H2Cl2F5I |
|---|---|
| Molecular Weight | 342.86100 |
| Exact Mass | 341.85000 |
| LogP | 4.14050 |
| InChIKey | SOFCZMPCZNKHKJ-UHFFFAOYSA-N |
| SMILES | FC(F)(I)CC(F)(Cl)C(F)(F)Cl |
|
~%
1,2-dichloro-1,... CAS#:757-01-7 |
| Literature: Hauptschein et al. Journal of the American Chemical Society, 1958 , vol. 80, p. 846,847 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,2-dichloro-1,1,2,4,4-pentafluoro-4-iodo-butane |
| Butane,1,2-dichloro-1,1,2,4,4-pentafluoro-4-iodo |
| 1,2-Dichlor-1,1,2,4,4-pentafluor-4-jod-butan |