2-[(2,3-dibromopyrrol-1-yl)methoxy]ethyl-trimethylsilane structure
|
Common Name | 2-[(2,3-dibromopyrrol-1-yl)methoxy]ethyl-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 756893-97-7 | Molecular Weight | 355.14200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H17Br2NOSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[(2,3-dibromopyrrol-1-yl)methoxy]ethyl-trimethylsilane |
|---|
| Molecular Formula | C10H17Br2NOSi |
|---|---|
| Molecular Weight | 355.14200 |
| Exact Mass | 352.94500 |
| PSA | 14.16000 |
| LogP | 4.32540 |
| InChIKey | POWZAHAPPIDAQO-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CCOCn1ccc(Br)c1Br |
|
~%
2-[(2,3-dibromo... CAS#:756893-97-7 |
| Literature: Garg, Neil K.; Caspi, Daniel D.; Stoltz, Brian M. Journal of the American Chemical Society, 2004 , vol. 126, # 31 p. 9552 - 9553 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |