4-acetyl-5,6-bis(4-fluorophenyl)-2-(2-hydroxyethyl)pyridazin-3-one
Modify Date: 2024-10-05 20:37:23
4-acetyl-5,6-bis(4-fluorophenyl)-2-(2-hydroxyethyl)pyridazin-3-one structure
|
Common Name | 4-acetyl-5,6-bis(4-fluorophenyl)-2-(2-hydroxyethyl)pyridazin-3-one | ||
|---|---|---|---|---|
| CAS Number | 75644-00-7 | Molecular Weight | 370.34900 | |
| Density | 1.31g/cm3 | Boiling Point | 536.3ºC at 760 mmHg | |
| Molecular Formula | C20H16F2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.1ºC | |
| Name | 4-acetyl-5,6-bis(4-fluorophenyl)-2-(2-hydroxyethyl)pyridazin-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 536.3ºC at 760 mmHg |
| Molecular Formula | C20H16F2N2O3 |
| Molecular Weight | 370.34900 |
| Flash Point | 278.1ºC |
| Exact Mass | 370.11300 |
| PSA | 72.19000 |
| LogP | 3.05040 |
| Index of Refraction | 1.6 |
| InChIKey | WBPJQJDIALHLBQ-UHFFFAOYSA-N |
| SMILES | CC(=O)c1c(-c2ccc(F)cc2)c(-c2ccc(F)cc2)nn(CCO)c1=O |
|
~45%
4-acetyl-5,6-bi... CAS#:75644-00-7 |
| Literature: Buchman; Scozzie; Ariyan; Heilman; Rippin; Pyne; Powers; Matthews Journal of Medicinal Chemistry, 1980 , vol. 23, # 12 p. 1398 - 1405 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-(2'-hydroxyethyl)-4-acetyl-5,6-bis(p-fluorophenyl)-2H-pyridazin-3-one |