methyl 2-[3,4-bis(4-chlorophenyl)-5-cyano-6-oxopyridazin-1-yl]acetate
Modify Date: 2025-10-02 16:00:41
![methyl 2-[3,4-bis(4-chlorophenyl)-5-cyano-6-oxopyridazin-1-yl]acetate Structure](https://image.chemsrc.com/caspic/105/75643-86-6.png)
methyl 2-[3,4-bis(4-chlorophenyl)-5-cyano-6-oxopyridazin-1-yl]acetate structure
|
Common Name | methyl 2-[3,4-bis(4-chlorophenyl)-5-cyano-6-oxopyridazin-1-yl]acetate | ||
|---|---|---|---|---|
| CAS Number | 75643-86-6 | Molecular Weight | 414.24200 | |
| Density | 1.38g/cm3 | Boiling Point | 538.3ºC at 760 mmHg | |
| Molecular Formula | C20H13Cl2N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.4ºC | |
| Name | methyl 2-[3,4-bis(4-chlorophenyl)-5-cyano-6-oxopyridazin-1-yl]acetate |
|---|
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 538.3ºC at 760 mmHg |
| Molecular Formula | C20H13Cl2N3O3 |
| Molecular Weight | 414.24200 |
| Flash Point | 279.4ºC |
| Exact Mass | 413.03300 |
| PSA | 84.98000 |
| LogP | 3.92878 |
| Index of Refraction | 1.64 |
| InChIKey | AORGWHWYNIAQTN-UHFFFAOYSA-N |
| SMILES | COC(=O)Cn1nc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)c(C#N)c1=O |
|
~20%
methyl 2-[3,4-b... CAS#:75643-86-6 |
| Literature: Buchman; Scozzie; Ariyan; Heilman; Rippin; Pyne; Powers; Matthews Journal of Medicinal Chemistry, 1980 , vol. 23, # 12 p. 1398 - 1405 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |