3,4-bis(4-bromophenyl)-6-oxo-1H-pyridazine-5-carbonitrile structure
|
Common Name | 3,4-bis(4-bromophenyl)-6-oxo-1H-pyridazine-5-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 75643-28-6 | Molecular Weight | 431.08100 | |
| Density | 1.72g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H9Br2N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,4-bis(4-bromophenyl)-6-oxo-1H-pyridazine-5-carbonitrile |
|---|
| Density | 1.72g/cm3 |
|---|---|
| Molecular Formula | C17H9Br2N3O |
| Molecular Weight | 431.08100 |
| Exact Mass | 428.91100 |
| PSA | 69.80000 |
| LogP | 4.91288 |
| Index of Refraction | 1.708 |
| InChIKey | NNTMDFBMVJEDKC-UHFFFAOYSA-N |
| SMILES | N#Cc1c(-c2ccc(Br)cc2)c(-c2ccc(Br)cc2)n[nH]c1=O |
|
~47%
3,4-bis(4-bromo... CAS#:75643-28-6 |
| Literature: Buchman; Scozzie; Ariyan; Heilman; Rippin; Pyne; Powers; Matthews Journal of Medicinal Chemistry, 1980 , vol. 23, # 12 p. 1398 - 1405 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |