4-Pyridazinecarbonitrile, 5,6-bis(3,4-dichlorophenyl)-2,3-dihydro-3-ox o- structure
|
Common Name | 4-Pyridazinecarbonitrile, 5,6-bis(3,4-dichlorophenyl)-2,3-dihydro-3-ox o- | ||
|---|---|---|---|---|
| CAS Number | 75643-27-5 | Molecular Weight | 411.06900 | |
| Density | 1.57g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H7Cl4N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,4-bis(3,4-dichlorophenyl)-6-oxo-1H-pyridazine-5-carbonitrile |
|---|
| Density | 1.57g/cm3 |
|---|---|
| Molecular Formula | C17H7Cl4N3O |
| Molecular Weight | 411.06900 |
| Exact Mass | 408.93400 |
| PSA | 69.80000 |
| LogP | 6.00148 |
| Index of Refraction | 1.695 |
| InChIKey | XGNWXZMRWSOZOU-UHFFFAOYSA-N |
| SMILES | N#Cc1c(-c2ccc(Cl)c(Cl)c2)c(-c2ccc(Cl)c(Cl)c2)n[nH]c1=O |
|
~37%
4-Pyridazinecar... CAS#:75643-27-5 |
| Literature: Buchman; Scozzie; Ariyan; Heilman; Rippin; Pyne; Powers; Matthews Journal of Medicinal Chemistry, 1980 , vol. 23, # 12 p. 1398 - 1405 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |