2-phenyl-2-propyl-butanedioic acid
Modify Date: 2025-08-31 21:43:19
2-phenyl-2-propyl-butanedioic acid structure
|
Common Name | 2-phenyl-2-propyl-butanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 75542-33-5 | Molecular Weight | 236.26400 | |
| Density | 1.212g/cm3 | Boiling Point | 348.3ºC at 760 mmHg | |
| Molecular Formula | C13H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.6ºC | |
| Name | 2-phenyl-2-propylbutanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.212g/cm3 |
|---|---|
| Boiling Point | 348.3ºC at 760 mmHg |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.26400 |
| Flash Point | 178.6ºC |
| Exact Mass | 236.10500 |
| PSA | 74.60000 |
| LogP | 2.28380 |
| Index of Refraction | 1.545 |
| InChIKey | AOLREBWZLIOCII-UHFFFAOYSA-N |
| SMILES | CCCC(CC(=O)O)(C(=O)O)c1ccccc1 |
| HS Code | 2917399090 |
|---|
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-phenyl-2-propylsuccinic acid |
| 2-Phenyl-2-propyl-bernsteinsaeure |