4,6,7-trichloro-1,1,2,3,3,4,5,5,6,7,7-undecafluoro-hept-1-ene
Modify Date: 2025-09-18 19:14:40
4,6,7-trichloro-1,1,2,3,3,4,5,5,6,7,7-undecafluoro-hept-1-ene structure
|
Common Name | 4,6,7-trichloro-1,1,2,3,3,4,5,5,6,7,7-undecafluoro-hept-1-ene | ||
|---|---|---|---|---|
| CAS Number | 755-13-5 | Molecular Weight | 399.41600 | |
| Density | 1.724g/cm3 | Boiling Point | 193.4ºC at 760 mmHg | |
| Molecular Formula | C7Cl3F11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 95.1ºC | |
| Name | 4,6,7-trichloro-1,1,2,3,3,4,5,5,6,7,7-undecafluorohept-1-ene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.724g/cm3 |
|---|---|
| Boiling Point | 193.4ºC at 760 mmHg |
| Molecular Formula | C7Cl3F11 |
| Molecular Weight | 399.41600 |
| Flash Point | 95.1ºC |
| Exact Mass | 397.88900 |
| LogP | 5.97540 |
| Index of Refraction | 1.354 |
| InChIKey | OPNJDWSPEUABTI-UHFFFAOYSA-N |
| SMILES | FC(F)=C(F)C(F)(F)C(F)(Cl)C(F)(F)C(F)(Cl)C(F)(F)Cl |
|
~%
4,6,7-trichloro... CAS#:755-13-5 |
| Literature: Jing, Naiyong; Lemal, David M. Journal of Organic Chemistry, 1995 , vol. 60, # 1 p. 89 - 96 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4,6,7-trichloro-undecafluoro-hept-1-ene |
| 4,6,7-Trichlor-undecafluor-hept-1-en |
| 4,6,7-trichloro-4H,6H,7H-undecafluoro-hept-1-ene |
| 4,6,7-Trichlorperfluor-1-hepten |
| 4,6,7-TRICHLORO-1,1,2,3,3,4,5,5,6,7,7-UNDECAFLUORO-HEPT-1-ENE |
| 4,6,7-Trichloroperfluoro-1-heptene |