BIIK-0277 structure
|
Common Name | BIIK-0277 | ||
|---|---|---|---|---|
| CAS Number | 754926-25-5 | Molecular Weight | 267.36400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BIIK-0277BIIK-0277 is a β2-adrenoceptor agonist. Bronchodilator; tocolytic. Levalbuterol USP Related Compound E. |
| Name | 4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(ethoxymethyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H25NO3 |
|---|---|
| Molecular Weight | 267.36400 |
| Exact Mass | 267.18300 |
| PSA | 61.72000 |
| LogP | 2.74110 |
| InChIKey | TXFGJJYAMPXTIJ-UHFFFAOYSA-N |
| SMILES | CCOCc1cc(C(O)CNC(C)(C)C)ccc1O |
| RIDADR | NONH for all modes of transport |
|---|
| Levalbuterol related compound E |
| BIIK-0277 |
| UNII-71AVI2IB2S |