Tetrahydro-2H-pyran-2-ylmethyl 4-methylbenzenesulfonate structure
|
Common Name | Tetrahydro-2H-pyran-2-ylmethyl 4-methylbenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 75434-63-8 | Molecular Weight | 270.34500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Tetrahydro-2H-pyran-2-ylmethyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H18O4S |
|---|---|
| Molecular Weight | 270.34500 |
| Exact Mass | 270.09300 |
| PSA | 60.98000 |
| LogP | 3.35020 |
| InChIKey | YNBDZQRMEDQOQM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CCCCO2)cc1 |
| HS Code | 2932999099 |
|---|
|
~99%
Tetrahydro-2H-p... CAS#:75434-63-8 |
| Literature: Fleming; Wang; Steward Journal of Organic Chemistry, 2001 , vol. 66, # 6 p. 2171 - 2174 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-(toluenesulfonyl)aminobutyric acid |
| 2-(toluene-4-sulfonyloxymethyl)-tetrahydro-pyran |
| perhydro-2H-pyran-2-ylmethyl 4-methylbenzenesulfonate |
| 2-(Toluol-4-sulfonylamino)-buttersaeure |
| 2-(tosyloxy)cycloheptanone |
| 2-(toluene-4-sulfonylamino)-butyric acid |
| (tetrahydro-2H-pyran-2-yl)methyl 4-methylbenzenesulfonate |
| 2-(tosyloxymethyl)tetrahydrpyran |
| 2-{[(4-methylphenyl)sulfonyl]amino}butanoic acid |
| toluene-4-sulfonic acid tetrahydropyran-2-ylmethyl ester |
| Toluol-4-sulfonsaeure-tetrahydropyran-2-ylmethylester |