Astaxanthin structure
|
Common Name | Astaxanthin | ||
|---|---|---|---|---|
| CAS Number | 7542-45-2 | Molecular Weight | 596.83800 | |
| Density | 1.071 g/cm3 | Boiling Point | 774ºC at 760 mmHg | |
| Molecular Formula | C40H52O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 435.8ºC | |
| Name | Astaxanthin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.071 g/cm3 |
|---|---|
| Boiling Point | 774ºC at 760 mmHg |
| Molecular Formula | C40H52O4 |
| Molecular Weight | 596.83800 |
| Flash Point | 435.8ºC |
| Exact Mass | 596.38700 |
| PSA | 74.60000 |
| LogP | 8.90540 |
| Index of Refraction | 1.595 |
| InChIKey | MQZIGYBFDRPAKN-QISQUURKSA-N |
| SMILES | CC(C=CC=C(C)C=CC1=C(C)C(=O)C(O)CC1(C)C)=CC=CC=C(C)C=CC=C(C)C=CC1=C(C)C(=O)C(O)CC1(C)C |
| Storage condition | −20°C |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
| HS Code | 3203001990 |
| Precursor 8 | |
|---|---|
| DownStream 2 | |
| HS Code | 3203001990 |
|---|
| EINECS 231-424-6 |
| (all E)-astaxanthin |
| 6-hydroxy-3-[(1E,3E,5E,7Z,9E,11E,13E,15E,17E)-18-(4-hydroxy-2,6,6-trimethyl-3-oxocyclohexen-1-yl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-2,4,4-trimethylcyclohex-2-en-1-one |