Ethyl 4-Phosphanobenzoate structure
|
Common Name | Ethyl 4-Phosphanobenzoate | ||
|---|---|---|---|---|
| CAS Number | 75378-49-3 | Molecular Weight | 230.15400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-ethoxycarbonylphenyl)phosphonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H11O5P |
|---|---|
| Molecular Weight | 230.15400 |
| Exact Mass | 230.03400 |
| PSA | 93.64000 |
| LogP | 0.66630 |
| InChIKey | CNSKRLSOPSXLHJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(P(=O)(O)O)cc1 |
|
~%
Ethyl 4-Phospha... CAS#:75378-49-3 |
| Literature: Inoue, Atsushi; Shinokubo, Hiroshi; Oshima, Koichiro Journal of the American Chemical Society, 2003 , vol. 125, # 6 p. 1484 - 1485 |
|
~%
Ethyl 4-Phospha... CAS#:75378-49-3 |
| Literature: Michaelis Justus Liebigs Annalen der Chemie, 1896 , vol. 293, p. 265 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-Phosphonobenzoic Acid 1-Ethyl Ester |
| 4-Carbaethoxy-phenylphosphinsaeure |
| Ethyl 4-Phosphanobenzoate |