BTL-104 structure
|
Common Name | BTL-104 | ||
|---|---|---|---|---|
| CAS Number | 753451-66-0 | Molecular Weight | 766.95 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C40H50N10O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BTL-104BTL-104 is a monobiotinylated Phos-tag derivative for the detection of phosphopeptides and phosphoproteins[1]. |
| Name | BTL-104 |
|---|
| Description | BTL-104 is a monobiotinylated Phos-tag derivative for the detection of phosphopeptides and phosphoproteins[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C40H50N10O4S |
|---|---|
| Molecular Weight | 766.95 |
| InChIKey | UDSBDKQVXFAEAK-PEJPBKHASA-N |
| SMILES | O=C(CCCCC1SCC2NC(=O)NC21)NCCNC(=O)c1ccc(CN(Cc2ccccn2)CC(O)CN(Cc2ccccn2)Cc2ccccn2)nc1 |