Butanedioic acid,2-mercapto-, 1,4-dibutyl ester structure
|
Common Name | Butanedioic acid,2-mercapto-, 1,4-dibutyl ester | ||
|---|---|---|---|---|
| CAS Number | 7529-08-0 | Molecular Weight | 262.36600 | |
| Density | 1.057g/cm3 | Boiling Point | 348.6ºC at 760 mmHg | |
| Molecular Formula | C12H22O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218ºC | |
| Name | dibutyl 2-sulfanylbutanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.057g/cm3 |
|---|---|
| Boiling Point | 348.6ºC at 760 mmHg |
| Molecular Formula | C12H22O4S |
| Molecular Weight | 262.36600 |
| Flash Point | 218ºC |
| Exact Mass | 262.12400 |
| PSA | 91.40000 |
| LogP | 2.36150 |
| Index of Refraction | 1.468 |
| InChIKey | CEAVWKAXWLZMFB-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)CC(S)C(=O)OCCCC |
|
~%
Butanedioic aci... CAS#:7529-08-0 |
| Literature: Byrum,W.R. et al. Journal of Pharmaceutical Sciences, 1964 , vol. 53, p. 787 - 789 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| mercaptosuccinic acid dibutyl ester |
| Dibutyl mercaptosuccinate |
| Butanedioic acid,mercapto-,dibutyl ester |
| Mercaptobernsteinsaeure-dibutylester |
| Dibutyl 2-mercaptosuccinate |