ethyl 5-formyl-1,3-benzodioxole-4-carboxylate
Modify Date: 2025-08-30 11:33:06
ethyl 5-formyl-1,3-benzodioxole-4-carboxylate structure
|
Common Name | ethyl 5-formyl-1,3-benzodioxole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 75267-17-3 | Molecular Weight | 222.19400 | |
| Density | 1.333g/cm3 | Boiling Point | 383.6ºC at 760 mmHg | |
| Molecular Formula | C11H10O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.1ºC | |
| Name | ethyl 5-formyl-1,3-benzodioxole-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.333g/cm3 |
|---|---|
| Boiling Point | 383.6ºC at 760 mmHg |
| Molecular Formula | C11H10O5 |
| Molecular Weight | 222.19400 |
| Flash Point | 228.1ºC |
| Exact Mass | 222.05300 |
| PSA | 61.83000 |
| LogP | 1.40450 |
| Index of Refraction | 1.581 |
| InChIKey | FYGHEHXHPSPGQI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C=O)ccc2c1OCO2 |
| HS Code | 2932999099 |
|---|
|
~%
ethyl 5-formyl-... CAS#:75267-17-3 |
| Literature: Journal of Organic Chemistry, , vol. 45, # 25 p. 5067 - 5073 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
![Furo[3,4-e]-1,3-benzodioxole-6-carboxylicacid, 6,8-dihydro-8-oxo- structure](https://image.chemsrc.com/caspic/411/64395-07-9.png)
CAS#:64395-07-9| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethyl-5-formyl-1,3-benzodioxol-4-carboxylat |
| 1,3-Benzodioxole-4-carboxylicacid,5-formyl-,ethyl ester |