2-Propenoicacid, 3-[4-(benzoyloxy)phenyl]-
Modify Date: 2025-08-25 16:46:08
![2-Propenoicacid, 3-[4-(benzoyloxy)phenyl]- Structure](https://image.chemsrc.com/caspic/271/75175-10-9.png)
2-Propenoicacid, 3-[4-(benzoyloxy)phenyl]- structure
|
Common Name | 2-Propenoicacid, 3-[4-(benzoyloxy)phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 75175-10-9 | Molecular Weight | 268.26400 | |
| Density | 1.286g/cm3 | Boiling Point | 461.3ºC at 760mmHg | |
| Molecular Formula | C16H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174ºC | |
| Name | p-hydroxycinnamic acid, benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.286g/cm3 |
|---|---|
| Boiling Point | 461.3ºC at 760mmHg |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.26400 |
| Flash Point | 174ºC |
| Exact Mass | 268.07400 |
| PSA | 63.60000 |
| LogP | 3.00360 |
| Index of Refraction | 1.642 |
| InChIKey | KOKUTEOWSHGSAQ-FLIBITNWSA-N |
| SMILES | O=C(O)C=Cc1ccc(OC(=O)c2ccccc2)cc1 |
|
~%
2-Propenoicacid... CAS#:75175-10-9 |
| Literature: Dale; Hennis Journal of the American Chemical Society, 1958 , vol. 80, p. 3645,3648 |
|
~%
2-Propenoicacid... CAS#:75175-10-9 |
| Literature: Webster; Raiford Proceedings of the Iowa Academy of Science, 1940 , vol. 47, p. 249,252 Anm. d |
CAS#:32568-59-5
CAS#:2628-17-3| 4-Pyridyl benzoate |
| 4-Benzoyloxy-trans-zimtsaeure |
| 4-benzoyloxy-trans-cinnamic acid |
| benzoic acid 4-pyridinyl ester |
| 4-Benzoyloxypyridin |