5-[[2,3,4,5,6-pentakis(benzo[1,3]dioxol-5-ylmethylsulfanylmethyl)phenyl]methylsulfanylmethyl]benzo[1,3]dioxole structure
|
Common Name | 5-[[2,3,4,5,6-pentakis(benzo[1,3]dioxol-5-ylmethylsulfanylmethyl)phenyl]methylsulfanylmethyl]benzo[1,3]dioxole | ||
|---|---|---|---|---|
| CAS Number | 75155-60-1 | Molecular Weight | 1159.45000 | |
| Density | 1.446g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C60H54O12S6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[[2,3,4,5,6-pentakis(1,3-benzodioxol-5-ylmethylsulfanylmethyl)phenyl]methylsulfanylmethyl]-1,3-benzodioxole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.446g/cm3 |
|---|---|
| Molecular Formula | C60H54O12S6 |
| Molecular Weight | 1159.45000 |
| Exact Mass | 1158.19000 |
| PSA | 262.56000 |
| LogP | 14.65920 |
| Index of Refraction | 1.716 |
| InChIKey | KPPTZCHCIGHCSV-UHFFFAOYSA-N |
| SMILES | c1cc2c(cc1CSCc1c(CSCc3ccc4c(c3)OCO4)c(CSCc3ccc4c(c3)OCO4)c(CSCc3ccc4c(c3)OCO4)c(CSCc3ccc4c(c3)OCO4)c1CSCc1ccc3c(c1)OCO3)OCO2 |
|
~%
5-[[2,3,4,5,6-p... CAS#:75155-60-1 |
| Literature: Hardy, Andrew D. U.; MacNicol, David D.; Swanson, Stephen; Wilson, Derek R. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1980 , p. 999 - 1005 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| hexakis-(3,4-methylenedioxybenzylthiomethyl)benzene |