4-nitro-3-(4-nitrophenyl)-1-phenylbutan-1-one
Modify Date: 2025-08-25 16:03:58
4-nitro-3-(4-nitrophenyl)-1-phenylbutan-1-one structure
|
Common Name | 4-nitro-3-(4-nitrophenyl)-1-phenylbutan-1-one | ||
|---|---|---|---|---|
| CAS Number | 75141-81-0 | Molecular Weight | 314.29300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-nitro-3-(4-nitrophenyl)-1-phenylbutan-1-one |
|---|
| Molecular Formula | C16H14N2O5 |
|---|---|
| Molecular Weight | 314.29300 |
| Exact Mass | 314.09000 |
| PSA | 108.71000 |
| LogP | 4.27450 |
| InChIKey | VQNGFFCDFCPMQU-UHFFFAOYSA-N |
| SMILES | O=C(CC(C[N+](=O)[O-])c1ccc([N+](=O)[O-])cc1)c1ccccc1 |
|
~75%
4-nitro-3-(4-ni... CAS#:75141-81-0 |
| Literature: Li, Ji-Tai; Cui, Yong; Chen, Guo-Feng; Cheng, Zhao-Li; Li, Tong-Shuang Synthetic Communications, 2003 , vol. 33, # 3 p. 353 - 359 |
|
~72%
4-nitro-3-(4-ni... CAS#:75141-81-0 |
| Literature: Watanabe, Ken-ichi; Miyazu, Ken-ichi; Irie, Kazuro Bulletin of the Chemical Society of Japan, 1982 , vol. 55, # 10 p. 3212 - 3215 |
![[(E)-4-Nitrostyryl]phenyl ketone structure](https://image.chemsrc.com/caspic/073/2960-55-6.png)
| Precursor 3 | |
|---|---|
| DownStream 0 | |