3-benzyl-6-bromo-4-hydroxy-naphthalene-1,2-dione
Modify Date: 2025-09-01 11:54:18
3-benzyl-6-bromo-4-hydroxy-naphthalene-1,2-dione structure
|
Common Name | 3-benzyl-6-bromo-4-hydroxy-naphthalene-1,2-dione | ||
|---|---|---|---|---|
| CAS Number | 7512-52-9 | Molecular Weight | 343.17100 | |
| Density | 1.634g/cm3 | Boiling Point | 514.6ºC at 760 mmHg | |
| Molecular Formula | C17H11BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265ºC | |
| Name | 3-benzyl-6-bromo-4-hydroxynaphthalene-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.634g/cm3 |
|---|---|
| Boiling Point | 514.6ºC at 760 mmHg |
| Molecular Formula | C17H11BrO3 |
| Molecular Weight | 343.17100 |
| Flash Point | 265ºC |
| Exact Mass | 341.98900 |
| PSA | 54.37000 |
| LogP | 3.88290 |
| Index of Refraction | 1.701 |
| InChIKey | LRHJOSTXBKEGMK-UHFFFAOYSA-N |
| SMILES | O=C1C(=O)c2ccc(Br)cc2C(O)=C1Cc1ccccc1 |
|
~%
3-benzyl-6-brom... CAS#:7512-52-9 |
| Literature: Fieser; Hartwell; Seligman Journal of the American Chemical Society, 1936 , vol. 58, p. 1223,1227 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-Benzyl-6-brom-2-hydroxy-1,4-naphthochinon |
| 3-benzyl-6-bromo-2-hydroxy-[1,4]naphthoquinone |