N-butyl-N-[2-[2-[2-(dibutylamino)ethylsulfanyl]ethylsulfanyl]ethyl]butan-1-amine structure
|
Common Name | N-butyl-N-[2-[2-[2-(dibutylamino)ethylsulfanyl]ethylsulfanyl]ethyl]butan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 7512-33-6 | Molecular Weight | 404.76000 | |
| Density | 0.932g/cm3 | Boiling Point | 491.2ºC at 760 mmHg | |
| Molecular Formula | C22H48N2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.8ºC | |
| Name | N-butyl-N-[2-[2-[2-(dibutylamino)ethylsulfanyl]ethylsulfanyl]ethyl]butan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.932g/cm3 |
|---|---|
| Boiling Point | 491.2ºC at 760 mmHg |
| Molecular Formula | C22H48N2S2 |
| Molecular Weight | 404.76000 |
| Flash Point | 250.8ºC |
| Exact Mass | 404.32600 |
| PSA | 57.08000 |
| LogP | 6.25720 |
| Index of Refraction | 1.498 |
| InChIKey | QHAQVNKPEREDDT-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCC)CCSCCSCCN(CCCC)CCCC |
|
~%
N-butyl-N-[2-[2... CAS#:7512-33-6 |
| Literature: Price; Roberts Journal of Organic Chemistry, 1947 , vol. 12, p. 264,266 |
|
~%
N-butyl-N-[2-[2... CAS#:7512-33-6 |
| Literature: Price; Roberts Journal of Organic Chemistry, 1947 , vol. 12, p. 264,266 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,2-bis-(2-dibutylamino-ethylsulfanyl)-ethane |
| 1,2-Bis-(2-dibutylamino-aethylmercapto)-aethan |