2,4,6-tripentyl-1,3,5-trioxane structure
|
Common Name | 2,4,6-tripentyl-1,3,5-trioxane | ||
|---|---|---|---|---|
| CAS Number | 7510-30-7 | Molecular Weight | 300.47700 | |
| Density | 0.881g/cm3 | Boiling Point | 361.9ºC at 760 mmHg | |
| Molecular Formula | C18H36O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 122.1ºC | |
| Name | 2,4,6-tripentyl-1,3,5-trioxane |
|---|
| Density | 0.881g/cm3 |
|---|---|
| Boiling Point | 361.9ºC at 760 mmHg |
| Molecular Formula | C18H36O3 |
| Molecular Weight | 300.47700 |
| Flash Point | 122.1ºC |
| Exact Mass | 300.26600 |
| PSA | 27.69000 |
| LogP | 5.76900 |
| Index of Refraction | 1.431 |
| InChIKey | DWHYTUCIGWHOBO-UHFFFAOYSA-N |
| SMILES | CCCCCC1OC(CCCCC)OC(CCCCC)O1 |
|
~83%
2,4,6-tripentyl... CAS#:7510-30-7 |
| Literature: Sato, Satoshi; Furuta, Hiromi; Sodesawa, Toshiaki; Nozaki, Fumio Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1993 , # 3 p. 385 - 390 |
|
~0%
2,4,6-tripentyl... CAS#:7510-30-7
Detail
|
| Literature: Tietze, Lutz F.; Beller, Matthias Angewandte Chemie, 1991 , vol. 103, # 7 p. 878 - 880 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |