2-cyclohexyl-3-cyclopentyl-3-hydroxy-propanoic acid structure
|
Common Name | 2-cyclohexyl-3-cyclopentyl-3-hydroxy-propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 7505-58-0 | Molecular Weight | 240.33900 | |
| Density | 1.125g/cm3 | Boiling Point | 405.3ºC at 760 mmHg | |
| Molecular Formula | C14H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.1ºC | |
| Name | 2-cyclohexyl-3-cyclopentyl-3-hydroxypropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.125g/cm3 |
|---|---|
| Boiling Point | 405.3ºC at 760 mmHg |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.33900 |
| Flash Point | 213.1ºC |
| Exact Mass | 240.17300 |
| PSA | 57.53000 |
| LogP | 2.81860 |
| Index of Refraction | 1.526 |
| InChIKey | YDVOBQKVBDHHIP-UHFFFAOYSA-N |
| SMILES | O=C(O)C(C1CCCCC1)C(O)C1CCCC1 |
|
~%
2-cyclohexyl-3-... CAS#:7505-58-0 |
| Literature: Blicke; Zinnes Journal of the American Chemical Society, 1955 , vol. 77, p. 6247 |
|
~%
2-cyclohexyl-3-... CAS#:7505-58-0 |
| Literature: Blicke; Zinnes Journal of the American Chemical Society, 1955 , vol. 77, p. 6247 |
|
~%
2-cyclohexyl-3-... CAS#:7505-58-0 |
| Literature: Blicke; Zinnes Journal of the American Chemical Society, 1955 , vol. 77, p. 6247 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-Cyclohexyl-3-cyclopentyl-3-hydroxy-propionsaeure |
| 2-cyclohexyl-3-cyclopentyl-3-hydroxy-propionic acid |