2-(2,4-dichlorophenoxy)-N-(3-nitrophenyl)acetamide structure
|
Common Name | 2-(2,4-dichlorophenoxy)-N-(3-nitrophenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 75004-50-1 | Molecular Weight | 341.14600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10Cl2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2,4-dichlorophenoxy)-N-(3-nitrophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H10Cl2N2O4 |
|---|---|
| Molecular Weight | 341.14600 |
| Exact Mass | 340.00200 |
| PSA | 87.64000 |
| LogP | 5.09180 |
| InChIKey | QMKZYMMHEUQWHV-UHFFFAOYSA-N |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)Nc1cccc([N+](=O)[O-])c1 |
|
~%
2-(2,4-dichloro... CAS#:75004-50-1 |
| Literature: Johnston,A.M. Journal of the Chemical Society, 1961 , p. 2335 - 2337 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| <N-3-Nitro-phenyl>-2,4-dichlor-phenoxy-acetamid |