2,4-dinitro-N-[(2,2,6-trimethylcyclohexylidene)amino]aniline
Modify Date: 2025-09-01 18:03:21
![2,4-dinitro-N-[(2,2,6-trimethylcyclohexylidene)amino]aniline Structure](https://image.chemsrc.com/caspic/101/7500-43-8.png)
2,4-dinitro-N-[(2,2,6-trimethylcyclohexylidene)amino]aniline structure
|
Common Name | 2,4-dinitro-N-[(2,2,6-trimethylcyclohexylidene)amino]aniline | ||
|---|---|---|---|---|
| CAS Number | 7500-43-8 | Molecular Weight | 320.34400 | |
| Density | 1.33g/cm3 | Boiling Point | 440.2ºC at 760 mmHg | |
| Molecular Formula | C15H20N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220ºC | |
| Name | 2,4-dinitro-N-[(Z)-(2,2,6-trimethylcyclohexylidene)amino]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 440.2ºC at 760 mmHg |
| Molecular Formula | C15H20N4O4 |
| Molecular Weight | 320.34400 |
| Flash Point | 220ºC |
| Exact Mass | 320.14800 |
| PSA | 116.03000 |
| LogP | 5.23650 |
| Index of Refraction | 1.617 |
| InChIKey | BLJMZIWRKOHZPD-VKAVYKQESA-N |
| SMILES | CC1CCCC(C)(C)C1=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
|
~%
2,4-dinitro-N-[... CAS#:7500-43-8 |
| Literature: Sobotka; Chanley Journal of the American Chemical Society, 1949 , vol. 71, p. 4136,4138 Show Details Lardelli; Jeger Helvetica Chimica Acta, 1949 , vol. 32, p. 1817,1832 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,2,6-trimethyl-cyclohexanone-(2,4-dinitro-phenylhydrazone) |
| 2,2,6-Trimethyl-cyclohexanon-(2,4-dinitro-phenylhydrazon) |
| 4-phenyl-4,5-dihydrothiophene-1,1-dione |
| 2,2,6-trimethylcyclohexane carbaldehyde |
| 2,2,6-trimethylcyclohexane-1-carbaldehyde |
| (1R,6S)-2,2,6-trimethylcyclohexyl carbaldehyde |
| 2,4-Dinitro-phenylhydrazon des 1,1,3-Trimethyl-cyclohexanon-(6) |
| dihydrocyclocitral |
| (3S)-3-phenyl-2,3-dihydrothiophene 1,1-dioxide |