8-Methoxy-4,5-dihydronaphtho[1,2-c]furan-1,3-dione structure
|
Common Name | 8-Methoxy-4,5-dihydronaphtho[1,2-c]furan-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 7498-68-2 | Molecular Weight | 230.21600 | |
| Density | 1.38g/cm3 | Boiling Point | 438.7ºC at 760 mmHg | |
| Molecular Formula | C13H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.8ºC | |
| Name | 8-methoxy-4,5-dihydrobenzo[e][2]benzofuran-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 438.7ºC at 760 mmHg |
| Molecular Formula | C13H10O4 |
| Molecular Weight | 230.21600 |
| Flash Point | 199.8ºC |
| Exact Mass | 230.05800 |
| PSA | 52.60000 |
| LogP | 1.47840 |
| Index of Refraction | 1.617 |
| InChIKey | GAPHZUOZXHMVEX-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)C1=C(CC2)C(=O)OC1=O |
|
~%
8-Methoxy-4,5-d... CAS#:7498-68-2 |
| Literature: Fieser; Hershberg Journal of the American Chemical Society, 1936 , vol. 58, p. 2314,2316 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 8-Methoxy-4,5-dihydronaphtho(1,2-c)furan-1,3-dione |
| 7-Methoxy-3,4-dihydro-naphthalin-1,2-dicarbonsaeure-anhydrid |
| 7-methoxy-3,4-dihydro-naphthalene-1,2-dicarboxylic acid-anhydride |