1-arabinofuranosyl-5-ethynylcytosine structure
|
Common Name | 1-arabinofuranosyl-5-ethynylcytosine | ||
|---|---|---|---|---|
| CAS Number | 74954-66-8 | Molecular Weight | 215.24900 | |
| Density | 1.67g/cm3 | Boiling Point | 518.7ºC at 760 mmHg | |
| Molecular Formula | C7H5NO3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.5ºC | |
| Name | 4-isothiocyanatobenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.67g/cm3 |
|---|---|
| Boiling Point | 518.7ºC at 760 mmHg |
| Molecular Formula | C7H5NO3S2 |
| Molecular Weight | 215.24900 |
| Flash Point | 267.5ºC |
| Exact Mass | 214.97100 |
| PSA | 107.20000 |
| LogP | 2.74840 |
| Index of Refraction | 1.698 |
| InChIKey | NCZFDEBKMUJQQO-BDNRQGISSA-N |
| SMILES | C#Cc1cn(C2OC(CO)C(O)C2O)c(=O)nc1N |
|
~67%
1-arabinofurano... CAS#:74954-66-8 |
| Literature: Bobek; Kavai; Sharma; Grill; Dutschman; Cheng Journal of Medicinal Chemistry, 1987 , vol. 30, # 11 p. 2154 - 2157 |
|
~%
1-arabinofurano... CAS#:74954-66-8 |
| Literature: Bobek; Kavai; Sharma; Grill; Dutschman; Cheng Journal of Medicinal Chemistry, 1987 , vol. 30, # 11 p. 2154 - 2157 |
|
~%
1-arabinofurano... CAS#:74954-66-8 |
| Literature: Bobek; Kavai; Sharma; Grill; Dutschman; Cheng Journal of Medicinal Chemistry, 1987 , vol. 30, # 11 p. 2154 - 2157 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-Sulfophenyl isothiocyanate |
| p-Isothiocyanatobenzenesulfonate |
| para-Isothiocyanatobenzenesulfonate |