N-(3-oxo-1-phenyl-hexan-2-yl)butanamide structure
|
Common Name | N-(3-oxo-1-phenyl-hexan-2-yl)butanamide | ||
|---|---|---|---|---|
| CAS Number | 7495-60-5 | Molecular Weight | 261.35900 | |
| Density | 1.014g/cm3 | Boiling Point | 442.8ºC at 760 mmHg | |
| Molecular Formula | C16H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.4ºC | |
| Name | N-(3-oxo-1-phenylhexan-2-yl)butanamide |
|---|
| Density | 1.014g/cm3 |
|---|---|
| Boiling Point | 442.8ºC at 760 mmHg |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.35900 |
| Flash Point | 158.4ºC |
| Exact Mass | 261.17300 |
| PSA | 46.17000 |
| LogP | 3.27410 |
| Index of Refraction | 1.505 |
| InChIKey | VTKCMXPVSJHHRK-UHFFFAOYSA-N |
| SMILES | CCCC(=O)NC(Cc1ccccc1)C(=O)CCC |
|
~%
N-(3-oxo-1-phen... CAS#:7495-60-5 |
| Literature: Cleland; Niemann Journal of the American Chemical Society, 1949 , vol. 71, p. 841 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |