3-[(2-chlorophenyl)methylidene]-4-[(2-methoxyphenyl)methylidene]oxolane-2,5-dione
Modify Date: 2025-10-04 13:26:00
![3-[(2-chlorophenyl)methylidene]-4-[(2-methoxyphenyl)methylidene]oxolane-2,5-dione Structure](https://image.chemsrc.com/caspic/105/7495-54-7.png)
3-[(2-chlorophenyl)methylidene]-4-[(2-methoxyphenyl)methylidene]oxolane-2,5-dione structure
|
Common Name | 3-[(2-chlorophenyl)methylidene]-4-[(2-methoxyphenyl)methylidene]oxolane-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 7495-54-7 | Molecular Weight | 340.75700 | |
| Density | 1.394g/cm3 | Boiling Point | 540.9ºC at 760 mmHg | |
| Molecular Formula | C19H13ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.3ºC | |
| Name | (3E,4Z)-3-[(2-chlorophenyl)methylidene]-4-[(2-methoxyphenyl)methylidene]oxolane-2,5-dione |
|---|
| Density | 1.394g/cm3 |
|---|---|
| Boiling Point | 540.9ºC at 760 mmHg |
| Molecular Formula | C19H13ClO4 |
| Molecular Weight | 340.75700 |
| Flash Point | 214.3ºC |
| Exact Mass | 340.05000 |
| PSA | 52.60000 |
| LogP | 3.89900 |
| Index of Refraction | 1.688 |
| InChIKey | IEJCFPVKJKXDLI-AIWUCEOPSA-N |
| SMILES | COc1ccccc1C=C1C(=O)OC(=O)C1=Cc1ccccc1Cl |
|
~%
3-[(2-chlorophe... CAS#:7495-54-7 |
| Literature: Baddar et al. Journal of the Chemical Society, 1959 , p. 1016,1019 |
|
~%
3-[(2-chlorophe... CAS#:7495-54-7 |
| Literature: Baddar et al. Journal of the Chemical Society, 1959 , p. 1016,1019 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |